screenMAG
screenMAG-particles are magnetic-fluorescent beads based on the well-known SiMAG technology. The advantage of both innovative techniques - the magnetic- and the fluorescence properties - provide exciting new possibilities to explore new fields of application in biosciences.
| Fluorescence Type |
Fluorescence Color |
Excitation | Emission |
|---|---|---|---|
| screenMAG/B | blue | 400 nm | 420 nm |
| screenMAG/G | green | 502 nm | 525 nm |
| screenMAG/O | orange | 526 nm | 555 nm |
| screenMAG/OP | orange | 536 nm | 617 nm |
| screenMAG/RR | red | 540 nm | 625 nm |
| screenMAG/R | red | 633 nm | 672 nm |
 |
 |
| screenMAG/G | screenMAG/O |
screenMAG-active - terminal reactive groups of the magnetic-fluorescent beads allow the convenient and efficient covalent binding of bioaffine ligands. This is a unique feature accounting for the rapidly increasing number and variation of novel and different receptor-affine biological substances.
| Application: | Magnetic separation and fluorescence identification of targets | |
| Formulation: | suspension in ddH2O, autoclaved | |
| Concentration: | 50 mg/ml | |
| Particle sizes: | 0.5 µm, 1.0 µm | |
| Price: | 1 ml - 35 EURO / 46 US$ | 5 ml - 140 EURO / 182 US$ |
| Functional Group | Product Number | Quantity (ml) | Activation / Coupling | Product Information |
|---|---|---|---|---|
screenMAG-Amine
- Si-(CH2)3-NH2
|
2101-1 2101-5 |
1 5 |
Carbodiimide method Attachment: amino groups see protocol: A2/3 |
 |
|
screenMAG-Carboxyl
- Si-(CH2)3-COOH
|
2102-1 2102-5 |
1 5 |
Carbodiimide method Attachment: amino groups see protocol: A1 |
|
screenMAG-Cyanuric
-Si-(CH2)3
|
2103-1 2103-5 |
1 5 |
Cyanuric chloride, auto-reactive see coupling protocol: A8 |
|
|
screenMAG-Hydrazide
- Si-(CH2)3~CO-NH-NH2
|
2104-1 2104-5 |
1 5 |
Oxidized carbohydrats Attachment: aldehyde see protocol: A5 |
|
|
screenMAG-Hydroxyl
- Si-(CH2)3-OH
|
2105-1 2105-5 |
1 5 |
Cyanogen bromide activation see protocol: A7 |
|
|
screenMAG-PEI
- Si-(CH2)3-(CH2-CH2-N+H)n- CH2-CH2-NH2 |
2106-1 2106-5 |
1 5 |
Strong anion-exchanger | |
|
screenMAG-Silanol
- Si-OH
|
2107-1 2107-5 |
1 5 |
Purification of DNA/RNA, adsorption of biomolecules | |
|
screenMAG-Thiol
- Si-(CH2)3-SH
|
2108-1 2108-5 |
1 5 |
Maleimides Attachment: thiol groups |
|
screenMAG-affinity - bioaffine ligands are covalently bound to the magnetic-fluorescent particles. High selectivity and high capacity make these products for an ideal tool for the isolation of specific biomolecules.
| Application: | Affinity chromatography | |
| Formulation: | buffer suspension, 0.01 NaN3 | |
| Concentration: | 10 mg/ml | |
| Particle sizes: | 0.5 µm, 1.0 µm | |
| Price: | 1 ml - 60 EURO / 78 US$ | 5 ml - 240 EURO / 312 US$ |
| Affinity Group | Product Number | Quantity (ml) | Application for: Purification / Binding |
Product Information |
|---|---|---|---|---|
| Biotin | 2201-1 2201-5 |
1 5 |
Avidin/streptavidin labeled molecules | |
| Goat anti-mouse IgG (Fc specific) |
2202-1 2202-5 |
1 5 |
Binding of secondary antibody See protocol: B4 |
|
| Protein A | 2203-1 2203-5 |
1 5 |
Antibodies see protocol: B2 |
|
| Protein G | 2204-1 2204-5 |
1 5 |
|
|
| Streptavidin | 2205-1 2205-5 |
1 5 |
Biotin-labeled molecules See protocol: B1 |
|
